C21H17N5O8 — CID 4779477
N,N'-bis(4-methoxyphenyl)-N-(2,4,6-trinitrophenyl)methanimidamide (PubChem CID 4779477) has the molecular formula C21H17N5O8 and a molecular weight of 467.39 g/mol. Its IUPAC name is N,N'-bis(4-methoxyphenyl)-N-(2,4,6-trinitrophenyl)methanimidamide.
| Compound Name | N,N'-bis(4-methoxyphenyl)-N-(2,4,6-trinitrophenyl)methanimidamide |
|---|---|
| PubChem CID | 4779477 |
| Molecular Formula | C21H17N5O8 |
| Molecular Weight | 467.39 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | N,N'-bis(4-methoxyphenyl)-N-(2,4,6-trinitrophenyl)methanimidamide |
| SMILES | COc1ccc(/N=C/N(c2ccc(OC)cc2)c2c([N+](=O)[O-])cc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H17N5O8/c1-33-17-7-3-14(4-8-17)22-13-23(15-5-9-18(34-2)10-6-15)21-19(25(29)30)11-16(24(27)28)12-20(21)26(31)32/h3-13H,1-2H3/b22-13+ |
| InChIKey | QCGYSYMVNPXYNA-LPYMAVHISA-N |
| XLogP | 4.93 |
| TPSA | 163.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.39 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|