C16H16N4O5 — CID 11210099
N'-[4-(4-methoxyphenyl)-2,6-dinitrophenyl]-N,N-dimethylmethanimidamide (PubChem CID 11210099) has the molecular formula C16H16N4O5 and a molecular weight of 344.33 g/mol. Its IUPAC name is N'-[4-(4-methoxyphenyl)-2,6-dinitrophenyl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[4-(4-methoxyphenyl)-2,6-dinitrophenyl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 11210099 |
| Molecular Formula | C16H16N4O5 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | N'-[4-(4-methoxyphenyl)-2,6-dinitrophenyl]-N,N-dimethylmethanimidamide |
| SMILES | COc1ccc(-c2cc([N+](=O)[O-])c(/N=C/N(C)C)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C16H16N4O5/c1-18(2)10-17-16-14(19(21)22)8-12(9-15(16)20(23)24)11-4-6-13(25-3)7-5-11/h4-10H,1-3H3/b17-10+ |
| InChIKey | ZYMYMPLTWFUPAM-LICLKQGHSA-N |
| XLogP | 3.40 |
| TPSA | 111.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|