C14H14N4O3 — CID 166539493
N,N-dimethyl-N'-[4-(4-nitrophenoxy)-2-pyridinyl]methanimidamide (PubChem CID 166539493) has the molecular formula C14H14N4O3 and a molecular weight of 286.29 g/mol. Its IUPAC name is N,N-dimethyl-N'-[4-(4-nitrophenoxy)-2-pyridinyl]methanimidamide.
| Compound Name | N,N-dimethyl-N'-[4-(4-nitrophenoxy)-2-pyridinyl]methanimidamide |
|---|---|
| PubChem CID | 166539493 |
| Molecular Formula | C14H14N4O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | N,N-dimethyl-N'-[4-(4-nitrophenoxy)-2-pyridinyl]methanimidamide |
| SMILES | CN(C)/C=N/c1cc(Oc2ccc([N+](=O)[O-])cc2)ccn1 |
| InChI | InChI=1S/C14H14N4O3/c1-17(2)10-16-14-9-13(7-8-15-14)21-12-5-3-11(4-6-12)18(19)20/h3-10H,1-2H3/b16-10+ |
| InChIKey | PFDZVLZGIOTTIY-MHWRWJLKSA-N |
| XLogP | 3.00 |
| TPSA | 80.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|