C10H10N4O2S — CID 121215620
N,N-dimethyl-N'-(5-nitro-1,3-benzothiazol-2-yl)methanimidamide (PubChem CID 121215620) has the molecular formula C10H10N4O2S and a molecular weight of 250.28 g/mol. Its IUPAC name is N,N-dimethyl-N'-(5-nitro-1,3-benzothiazol-2-yl)methanimidamide.
| Compound Name | N,N-dimethyl-N'-(5-nitro-1,3-benzothiazol-2-yl)methanimidamide |
|---|---|
| PubChem CID | 121215620 |
| Molecular Formula | C10H10N4O2S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | N,N-dimethyl-N'-(5-nitro-1,3-benzothiazol-2-yl)methanimidamide |
| SMILES | CN(C)/C=N/c1nc2cc([N+](=O)[O-])ccc2s1 |
| InChI | InChI=1S/C10H10N4O2S/c1-13(2)6-11-10-12-8-5-7(14(15)16)3-4-9(8)17-10/h3-6H,1-2H3/b11-6+ |
| InChIKey | FBWZCJVWKDHDSV-IZZDOVSWSA-N |
| XLogP | 2.43 |
| TPSA | 71.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|