C11H9N3O5S — CID 139222058
ethyl 2-[(5-nitro-1,3-benzothiazol-2-yl)amino]-2-oxoacetate (PubChem CID 139222058) has the molecular formula C11H9N3O5S and a molecular weight of 295.28 g/mol. Its IUPAC name is ethyl 2-[(5-nitro-1,3-benzothiazol-2-yl)amino]-2-oxoacetate.
| Compound Name | ethyl 2-[(5-nitro-1,3-benzothiazol-2-yl)amino]-2-oxoacetate |
|---|---|
| PubChem CID | 139222058 |
| Molecular Formula | C11H9N3O5S |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | ethyl 2-[(5-nitro-1,3-benzothiazol-2-yl)amino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)Nc1nc2cc([N+](=O)[O-])ccc2s1 |
| InChI | InChI=1S/C11H9N3O5S/c1-2-19-10(16)9(15)13-11-12-7-5-6(14(17)18)3-4-8(7)20-11/h3-5H,2H2,1H3,(H,12,13,15) |
| InChIKey | FRRUBTCDCKRXQO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|