C12H12N4O3S2 — CID 46192850
N-[(5-nitro-1,3-benzothiazol-2-yl)carbamothioyl]butanamide (PubChem CID 46192850) has the molecular formula C12H12N4O3S2 and a molecular weight of 324.39 g/mol. Its IUPAC name is N-[(5-nitro-1,3-benzothiazol-2-yl)carbamothioyl]butanamide.
| Compound Name | N-[(5-nitro-1,3-benzothiazol-2-yl)carbamothioyl]butanamide |
|---|---|
| PubChem CID | 46192850 |
| Molecular Formula | C12H12N4O3S2 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | N-[(5-nitro-1,3-benzothiazol-2-yl)carbamothioyl]butanamide |
| SMILES | CCCC(=O)NC(=S)Nc1nc2cc([N+](=O)[O-])ccc2s1 |
| InChI | InChI=1S/C12H12N4O3S2/c1-2-3-10(17)14-11(20)15-12-13-8-6-7(16(18)19)4-5-9(8)21-12/h4-6H,2-3H2,1H3,(H2,13,14,15,17,20) |
| InChIKey | YNKALNSCORLHLJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|