C18H12ClN5O3S — CID 135635044
2-(4-chlorophenyl)-5-methyl-4-[(E)-(6-nitro-1,3-benzothiazol-2-yl)iminomethyl]-1H-pyrazol-3-one (PubChem CID 135635044) has the molecular formula C18H12ClN5O3S and a molecular weight of 413.85 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5-methyl-4-[(E)-(6-nitro-1,3-benzothiazol-2-yl)iminomethyl]-1H-pyrazol-3-one.
| Compound Name | 2-(4-chlorophenyl)-5-methyl-4-[(E)-(6-nitro-1,3-benzothiazol-2-yl)iminomethyl]-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 135635044 |
| Molecular Formula | C18H12ClN5O3S |
| Molecular Weight | 413.85 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | 2-(4-chlorophenyl)-5-methyl-4-[(E)-(6-nitro-1,3-benzothiazol-2-yl)iminomethyl]-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(-c2ccc(Cl)cc2)c(=O)c1/C=N/c1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C18H12ClN5O3S/c1-10-14(17(25)23(22-10)12-4-2-11(19)3-5-12)9-20-18-21-15-7-6-13(24(26)27)8-16(15)28-18/h2-9,22H,1H3/b20-9+ |
| InChIKey | HCFOKMFNBHHIPX-AWQFTUOYSA-N |
| XLogP | 4.40 |
| TPSA | 106.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.85 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|