C19H15BrN4O2S — CID 1095600
2-(4-bromophenyl)-4-[(6-methoxy-1,3-benzothiazol-2-yl)iminomethyl]-5-methyl-1H-pyrazol-3-one (PubChem CID 1095600) has the molecular formula C19H15BrN4O2S and a molecular weight of 443.33 g/mol. Its IUPAC name is 2-(4-bromophenyl)-4-[(6-methoxy-1,3-benzothiazol-2-yl)iminomethyl]-5-methyl-1H-pyrazol-3-one.
| Compound Name | 2-(4-bromophenyl)-4-[(6-methoxy-1,3-benzothiazol-2-yl)iminomethyl]-5-methyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 1095600 |
| Molecular Formula | C19H15BrN4O2S |
| Molecular Weight | 443.33 g/mol |
| Exact Mass | 442.01 |
| IUPAC Name | 2-(4-bromophenyl)-4-[(6-methoxy-1,3-benzothiazol-2-yl)iminomethyl]-5-methyl-1H-pyrazol-3-one |
| SMILES | COc1ccc2nc(N=Cc3c(C)[nH]n(-c4ccc(Br)cc4)c3=O)sc2c1 |
| InChI | InChI=1S/C19H15BrN4O2S/c1-11-15(18(25)24(23-11)13-5-3-12(20)4-6-13)10-21-19-22-16-8-7-14(26-2)9-17(16)27-19/h3-10,23H,1-2H3 |
| InChIKey | YMHHRRGJEHOARO-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.33 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|