C19H13BrN4O3 — CID 5191845
5-[[2-(4-bromophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]isoindole-1,3-dione (PubChem CID 5191845) has the molecular formula C19H13BrN4O3 and a molecular weight of 425.24 g/mol. Its IUPAC name is 5-[[2-(4-bromophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]isoindole-1,3-dione.
| Compound Name | 5-[[2-(4-bromophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 5191845 |
| Molecular Formula | C19H13BrN4O3 |
| Molecular Weight | 425.24 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | 5-[[2-(4-bromophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]isoindole-1,3-dione |
| SMILES | Cc1[nH]n(-c2ccc(Br)cc2)c(=O)c1/C=N/c1ccc2c(c1)C(=O)NC2=O |
| InChI | InChI=1S/C19H13BrN4O3/c1-10-16(19(27)24(23-10)13-5-2-11(20)3-6-13)9-21-12-4-7-14-15(8-12)18(26)22-17(14)25/h2-9,23H,1H3,(H,22,25,26)/b21-9+ |
| InChIKey | YATNGGGXFJWJFF-ZVBGSRNCSA-N |
| XLogP | 2.87 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.24 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|