C18H15Br2N3O — CID 137073858
2-(4-bromo-3-methylphenyl)-4-[(4-bromophenyl)iminomethyl]-5-methyl-1H-pyrazol-3-one (PubChem CID 137073858) has the molecular formula C18H15Br2N3O and a molecular weight of 449.15 g/mol. Its IUPAC name is 2-(4-bromo-3-methylphenyl)-4-[(4-bromophenyl)iminomethyl]-5-methyl-1H-pyrazol-3-one.
| Compound Name | 2-(4-bromo-3-methylphenyl)-4-[(4-bromophenyl)iminomethyl]-5-methyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 137073858 |
| Molecular Formula | C18H15Br2N3O |
| Molecular Weight | 449.15 g/mol |
| Exact Mass | 446.96 |
| IUPAC Name | 2-(4-bromo-3-methylphenyl)-4-[(4-bromophenyl)iminomethyl]-5-methyl-1H-pyrazol-3-one |
| SMILES | Cc1cc(-n2[nH]c(C)c(/C=N/c3ccc(Br)cc3)c2=O)ccc1Br |
| InChI | InChI=1S/C18H15Br2N3O/c1-11-9-15(7-8-17(11)20)23-18(24)16(12(2)22-23)10-21-14-5-3-13(19)4-6-14/h3-10,22H,1-2H3/b21-10+ |
| InChIKey | UZIOKMXLZYRXRL-UFFVCSGVSA-N |
| XLogP | 5.06 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.15 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|