C18H13BrN4OS — CID 135628409
[4-[[2-(4-bromophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]phenyl] thiocyanate (PubChem CID 135628409) has the molecular formula C18H13BrN4OS and a molecular weight of 413.30 g/mol. Its IUPAC name is [4-[[2-(4-bromophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]phenyl] thiocyanate.
| Compound Name | [4-[[2-(4-bromophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 135628409 |
| Molecular Formula | C18H13BrN4OS |
| Molecular Weight | 413.30 g/mol |
| Exact Mass | 412.00 |
| IUPAC Name | [4-[[2-(4-bromophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]methylideneamino]phenyl] thiocyanate |
| SMILES | Cc1[nH]n(-c2ccc(Br)cc2)c(=O)c1/C=N/c1ccc(SC#N)cc1 |
| InChI | InChI=1S/C18H13BrN4OS/c1-12-17(10-21-14-4-8-16(9-5-14)25-11-20)18(24)23(22-12)15-6-2-13(19)3-7-15/h2-10,22H,1H3/b21-10+ |
| InChIKey | PHSZENWUYDQXRX-UFFVCSGVSA-N |
| XLogP | 4.56 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.30 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|