C17H12BrClN4O3 — CID 135628530
2-(4-bromophenyl)-4-[(2-chloro-4-nitrophenyl)iminomethyl]-5-methyl-1H-pyrazol-3-one (PubChem CID 135628530) has the molecular formula C17H12BrClN4O3 and a molecular weight of 435.67 g/mol. Its IUPAC name is 2-(4-bromophenyl)-4-[(2-chloro-4-nitrophenyl)iminomethyl]-5-methyl-1H-pyrazol-3-one.
| Compound Name | 2-(4-bromophenyl)-4-[(2-chloro-4-nitrophenyl)iminomethyl]-5-methyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 135628530 |
| Molecular Formula | C17H12BrClN4O3 |
| Molecular Weight | 435.67 g/mol |
| Exact Mass | 433.98 |
| IUPAC Name | 2-(4-bromophenyl)-4-[(2-chloro-4-nitrophenyl)iminomethyl]-5-methyl-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(-c2ccc(Br)cc2)c(=O)c1/C=N/c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C17H12BrClN4O3/c1-10-14(9-20-16-7-6-13(23(25)26)8-15(16)19)17(24)22(21-10)12-4-2-11(18)3-5-12/h2-9,21H,1H3/b20-9+ |
| InChIKey | JNEBKYLOAKMGLW-AWQFTUOYSA-N |
| XLogP | 4.55 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.67 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|