C17H13ClN6O5 — CID 3644709
2-(4-chlorophenyl)-4-[[(2,4-dinitrophenyl)hydrazinylidene]methyl]-5-methyl-1H-pyrazol-3-one (PubChem CID 3644709) has the molecular formula C17H13ClN6O5 and a molecular weight of 416.78 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-[[(2,4-dinitrophenyl)hydrazinylidene]methyl]-5-methyl-1H-pyrazol-3-one.
| Compound Name | 2-(4-chlorophenyl)-4-[[(2,4-dinitrophenyl)hydrazinylidene]methyl]-5-methyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 3644709 |
| Molecular Formula | C17H13ClN6O5 |
| Molecular Weight | 416.78 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 2-(4-chlorophenyl)-4-[[(2,4-dinitrophenyl)hydrazinylidene]methyl]-5-methyl-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(-c2ccc(Cl)cc2)c(=O)c1C=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H13ClN6O5/c1-10-14(17(25)22(21-10)12-4-2-11(18)3-5-12)9-19-20-15-7-6-13(23(26)27)8-16(15)24(28)29/h2-9,20-21H,1H3 |
| InChIKey | VENAJCFEDWHEPG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 148.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.78 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|