C11H8N6O6S — CID 135580287
5-[(E)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-6-hydroxy-2-sulfanylidene-1H-pyrimidin-4-one (PubChem CID 135580287) has the molecular formula C11H8N6O6S and a molecular weight of 352.29 g/mol. Its IUPAC name is 5-[(E)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-6-hydroxy-2-sulfanylidene-1H-pyrimidin-4-one.
| Compound Name | 5-[(E)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-6-hydroxy-2-sulfanylidene-1H-pyrimidin-4-one |
|---|---|
| PubChem CID | 135580287 |
| Molecular Formula | C11H8N6O6S |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | 5-[(E)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-6-hydroxy-2-sulfanylidene-1H-pyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)[nH]c(O)c1/C=N/Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H8N6O6S/c18-9-6(10(19)14-11(24)13-9)4-12-15-7-2-1-5(16(20)21)3-8(7)17(22)23/h1-4,15H,(H3,13,14,18,19,24)/b12-4+ |
| InChIKey | FJWVJPWCGXPQEP-UUILKARUSA-N |
| XLogP | 1.40 |
| TPSA | 179.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|