C12H8N4O6S — CID 137069407
2-[(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)methylideneamino]-4-nitrobenzoic acid (PubChem CID 137069407) has the molecular formula C12H8N4O6S and a molecular weight of 336.29 g/mol. Its IUPAC name is 2-[(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)methylideneamino]-4-nitrobenzoic acid.
| Compound Name | 2-[(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)methylideneamino]-4-nitrobenzoic acid |
|---|---|
| PubChem CID | 137069407 |
| Molecular Formula | C12H8N4O6S |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 2-[(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)methylideneamino]-4-nitrobenzoic acid |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])cc1/N=C/c1c(O)[nH]c(=S)[nH]c1=O |
| InChI | InChI=1S/C12H8N4O6S/c17-9-7(10(18)15-12(23)14-9)4-13-8-3-5(16(21)22)1-2-6(8)11(19)20/h1-4H,(H,19,20)(H3,14,15,17,18,23)/b13-4+ |
| InChIKey | MDGZMNKOMWCJJU-YIXHJXPBSA-N |
| XLogP | 1.50 |
| TPSA | 161.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|