C12H9N5O5S — CID 4516401
N-[(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)methylideneamino]-4-nitrobenzamide (PubChem CID 4516401) has the molecular formula C12H9N5O5S and a molecular weight of 335.30 g/mol. Its IUPAC name is N-[(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)methylideneamino]-4-nitrobenzamide.
| Compound Name | N-[(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)methylideneamino]-4-nitrobenzamide |
|---|---|
| PubChem CID | 4516401 |
| Molecular Formula | C12H9N5O5S |
| Molecular Weight | 335.30 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | N-[(6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidin-5-yl)methylideneamino]-4-nitrobenzamide |
| SMILES | O=C(NN=Cc1c(O)[nH]c(=S)[nH]c1=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H9N5O5S/c18-9(6-1-3-7(4-2-6)17(21)22)16-13-5-8-10(19)14-12(23)15-11(8)20/h1-5H,(H,16,18)(H3,14,15,19,20,23) |
| InChIKey | FZWYSXVDYWBGQD-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 153.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.30 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|