C36H28CrN8O10 — CID 170524979
chromium;bis(2-[(5-hydroxy-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-4-nitrobenzoic acid) (PubChem CID 170524979) has the molecular formula C36H28CrN8O10 and a molecular weight of 784.66 g/mol. Its IUPAC name is chromium;bis(2-[(5-hydroxy-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-4-nitrobenzoic acid).
| Compound Name | chromium;bis(2-[(5-hydroxy-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-4-nitrobenzoic acid) |
|---|---|
| PubChem CID | 170524979 |
| Molecular Formula | C36H28CrN8O10 |
| Molecular Weight | 784.66 g/mol |
| Exact Mass | 784.13 |
| IUPAC Name | chromium;bis(2-[(5-hydroxy-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-4-nitrobenzoic acid) |
| SMILES | Cc1nn(-c2ccccc2)c(O)c1/C=N/c1cc([N+](=O)[O-])ccc1C(=O)O.Cc1nn(-c2ccccc2)c(O)c1/C=N\c1cc([N+](=O)[O-])ccc1C(=O)O.[Cr] |
| InChI | InChI=1S/2C18H14N4O5.Cr/c2*1-11-15(17(23)21(20-11)12-5-3-2-4-6-12)10-19-16-9-13(22(26)27)7-8-14(16)18(24)25;/h2*2-10,23H,1H3,(H,24,25);/b19-10+;19-10-; |
| InChIKey | PVPWZUFHHDSJNH-YJCBKVFWSA-N |
| XLogP | 6.48 |
| TPSA | 261.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.66 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het_5_pyrazole_OH(14)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|