C36H32CoN8O12S2 — CID 170525033
cobalt;bis(4-[(2-hydroxy-5-methylsulfonylphenyl)iminomethyl]-3-methyl-1-(4-nitrophenyl)pyrazol-5-ol) (PubChem CID 170525033) has the molecular formula C36H32CoN8O12S2 and a molecular weight of 891.76 g/mol. Its IUPAC name is cobalt;bis(4-[(2-hydroxy-5-methylsulfonylphenyl)iminomethyl]-3-methyl-1-(4-nitrophenyl)pyrazol-5-ol).
| Compound Name | cobalt;bis(4-[(2-hydroxy-5-methylsulfonylphenyl)iminomethyl]-3-methyl-1-(4-nitrophenyl)pyrazol-5-ol) |
|---|---|
| PubChem CID | 170525033 |
| Molecular Formula | C36H32CoN8O12S2 |
| Molecular Weight | 891.76 g/mol |
| Exact Mass | 891.09 |
| IUPAC Name | cobalt;bis(4-[(2-hydroxy-5-methylsulfonylphenyl)iminomethyl]-3-methyl-1-(4-nitrophenyl)pyrazol-5-ol) |
| SMILES | Cc1nn(-c2ccc([N+](=O)[O-])cc2)c(O)c1/C=N\c1cc(S(C)(=O)=O)ccc1O.Cc1nn(-c2ccc([N+](=O)[O-])cc2)c(O)c1/C=N\c1cc(S(C)(=O)=O)ccc1O.[Co] |
| InChI | InChI=1S/2C18H16N4O6S.Co/c2*1-11-15(10-19-16-9-14(29(2,27)28)7-8-17(16)23)18(24)21(20-11)12-3-5-13(6-4-12)22(25)26;/h2*3-10,23-24H,1-2H3;/b2*19-10-; |
| InChIKey | DDTQLEDQACHONM-ZALDOVDQSA-N |
| XLogP | 5.31 |
| TPSA | 295.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.76 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|