C36H32Cl2CrN6O8S2 — CID 170524914
bis(1-(2-chlorophenyl)-4-[(2-hydroxy-5-methylsulfonylphenyl)iminomethyl]-3-methylpyrazol-5-ol);chromium (PubChem CID 170524914) has the molecular formula C36H32Cl2CrN6O8S2 and a molecular weight of 863.72 g/mol. Its IUPAC name is bis(1-(2-chlorophenyl)-4-[(2-hydroxy-5-methylsulfonylphenyl)iminomethyl]-3-methylpyrazol-5-ol);chromium.
| Compound Name | bis(1-(2-chlorophenyl)-4-[(2-hydroxy-5-methylsulfonylphenyl)iminomethyl]-3-methylpyrazol-5-ol);chromium |
|---|---|
| PubChem CID | 170524914 |
| Molecular Formula | C36H32Cl2CrN6O8S2 |
| Molecular Weight | 863.72 g/mol |
| Exact Mass | 862.05 |
| IUPAC Name | bis(1-(2-chlorophenyl)-4-[(2-hydroxy-5-methylsulfonylphenyl)iminomethyl]-3-methylpyrazol-5-ol);chromium |
| SMILES | Cc1nn(-c2ccccc2Cl)c(O)c1/C=N\c1cc(S(C)(=O)=O)ccc1O.Cc1nn(-c2ccccc2Cl)c(O)c1/C=N\c1cc(S(C)(=O)=O)ccc1O.[Cr] |
| InChI | InChI=1S/2C18H16ClN3O4S.Cr/c2*1-11-13(18(24)22(21-11)16-6-4-3-5-14(16)19)10-20-15-9-12(27(2,25)26)7-8-17(15)23;/h2*3-10,23-24H,1-2H3;/b2*20-10-; |
| InChIKey | INMNUPFCESGPAL-DBCPHBJFSA-N |
| XLogP | 6.80 |
| TPSA | 209.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.72 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|