C21H22FN3O4S — CID 170525007
5-tert-butyl-2-(2-fluorophenyl)-4-[(2-hydroxy-5-methylsulfonylphenyl)iminomethyl]-1H-pyrazol-3-one (PubChem CID 170525007) has the molecular formula C21H22FN3O4S and a molecular weight of 431.49 g/mol. Its IUPAC name is 5-tert-butyl-2-(2-fluorophenyl)-4-[(2-hydroxy-5-methylsulfonylphenyl)iminomethyl]-1H-pyrazol-3-one.
| Compound Name | 5-tert-butyl-2-(2-fluorophenyl)-4-[(2-hydroxy-5-methylsulfonylphenyl)iminomethyl]-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 170525007 |
| Molecular Formula | C21H22FN3O4S |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 5-tert-butyl-2-(2-fluorophenyl)-4-[(2-hydroxy-5-methylsulfonylphenyl)iminomethyl]-1H-pyrazol-3-one |
| SMILES | CC(C)(C)c1[nH]n(-c2ccccc2F)c(=O)c1/C=N/c1cc(S(C)(=O)=O)ccc1O |
| InChI | InChI=1S/C21H22FN3O4S/c1-21(2,3)19-14(20(27)25(24-19)17-8-6-5-7-15(17)22)12-23-16-11-13(30(4,28)29)9-10-18(16)26/h5-12,24,26H,1-4H3/b23-12+ |
| InChIKey | CPZOGTHDCUHWEB-FSJBWODESA-N |
| XLogP | 3.46 |
| TPSA | 104.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|