C17H14ClN3O2 — CID 170525058
4-[(4-chloro-2-hydroxyphenyl)iminomethyl]-5-methyl-2-phenyl-1H-pyrazol-3-one (PubChem CID 170525058) has the molecular formula C17H14ClN3O2 and a molecular weight of 327.77 g/mol. Its IUPAC name is 4-[(4-chloro-2-hydroxyphenyl)iminomethyl]-5-methyl-2-phenyl-1H-pyrazol-3-one.
| Compound Name | 4-[(4-chloro-2-hydroxyphenyl)iminomethyl]-5-methyl-2-phenyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 170525058 |
| Molecular Formula | C17H14ClN3O2 |
| Molecular Weight | 327.77 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 4-[(4-chloro-2-hydroxyphenyl)iminomethyl]-5-methyl-2-phenyl-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(-c2ccccc2)c(=O)c1/C=N/c1ccc(Cl)cc1O |
| InChI | InChI=1S/C17H14ClN3O2/c1-11-14(10-19-15-8-7-12(18)9-16(15)22)17(23)21(20-11)13-5-3-2-4-6-13/h2-10,20,22H,1H3/b19-10+ |
| InChIKey | DJEXZJRFBSAZMP-VXLYETTFSA-N |
| XLogP | 3.58 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.77 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|