C22H23N3O4 — CID 170524764
methyl 3-[(5-tert-butyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]-4-hydroxybenzoate (PubChem CID 170524764) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is methyl 3-[(5-tert-butyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]-4-hydroxybenzoate.
| Compound Name | methyl 3-[(5-tert-butyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]-4-hydroxybenzoate |
|---|---|
| PubChem CID | 170524764 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | methyl 3-[(5-tert-butyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]-4-hydroxybenzoate |
| SMILES | COC(=O)c1ccc(O)c(/N=C/c2c(C(C)(C)C)[nH]n(-c3ccccc3)c2=O)c1 |
| InChI | InChI=1S/C22H23N3O4/c1-22(2,3)19-16(20(27)25(24-19)15-8-6-5-7-9-15)13-23-17-12-14(21(28)29-4)10-11-18(17)26/h5-13,24,26H,1-4H3/b23-13+ |
| InChIKey | ORONVUPUCFEIDN-YDZHTSKRSA-N |
| XLogP | 3.71 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|