C19H18N4O6S — CID 170525172
ethyl 4-[(2-hydroxy-5-sulfamoylphenyl)iminomethyl]-3-oxo-2-phenyl-1H-pyrazole-5-carboxylate (PubChem CID 170525172) has the molecular formula C19H18N4O6S and a molecular weight of 430.44 g/mol. Its IUPAC name is ethyl 4-[(2-hydroxy-5-sulfamoylphenyl)iminomethyl]-3-oxo-2-phenyl-1H-pyrazole-5-carboxylate.
| Compound Name | ethyl 4-[(2-hydroxy-5-sulfamoylphenyl)iminomethyl]-3-oxo-2-phenyl-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 170525172 |
| Molecular Formula | C19H18N4O6S |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | ethyl 4-[(2-hydroxy-5-sulfamoylphenyl)iminomethyl]-3-oxo-2-phenyl-1H-pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1[nH]n(-c2ccccc2)c(=O)c1/C=N/c1cc(S(N)(=O)=O)ccc1O |
| InChI | InChI=1S/C19H18N4O6S/c1-2-29-19(26)17-14(18(25)23(22-17)12-6-4-3-5-7-12)11-21-15-10-13(30(20,27)28)8-9-16(15)24/h3-11,22,24H,2H2,1H3,(H2,20,27,28)/b21-11+ |
| InChIKey | LRTOMXQUMKOAFC-SRZZPIQSSA-N |
| XLogP | 1.45 |
| TPSA | 156.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|