C17H11N3O6S-2 — CID 135768316
3-oxo-4-(phenyliminomethyl)-2-(4-sulfonatophenyl)-1H-pyrazole-5-carboxylate (PubChem CID 135768316) has the molecular formula C17H11N3O6S-2 and a molecular weight of 385.36 g/mol. Its IUPAC name is 3-oxo-4-(phenyliminomethyl)-2-(4-sulfonatophenyl)-1H-pyrazole-5-carboxylate.
| Compound Name | 3-oxo-4-(phenyliminomethyl)-2-(4-sulfonatophenyl)-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 135768316 |
| Molecular Formula | C17H11N3O6S-2 |
| Molecular Weight | 385.36 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | 3-oxo-4-(phenyliminomethyl)-2-(4-sulfonatophenyl)-1H-pyrazole-5-carboxylate |
| SMILES | O=C([O-])c1[nH]n(-c2ccc(S(=O)(=O)[O-])cc2)c(=O)c1/C=N/c1ccccc1 |
| InChI | InChI=1S/C17H13N3O6S/c21-16-14(10-18-11-4-2-1-3-5-11)15(17(22)23)19-20(16)12-6-8-13(9-7-12)27(24,25)26/h1-10,19H,(H,22,23)(H,24,25,26)/p-2/b18-10+ |
| InChIKey | LIZFLZHRWIBPTH-VCHYOVAHSA-L |
| XLogP | 0.18 |
| TPSA | 147.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.36 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|