C18H16FN3O — CID 711577
4-[(4-fluorophenyl)iminomethyl]-5-methyl-2-(4-methylphenyl)-1H-pyrazol-3-one (PubChem CID 711577) has the molecular formula C18H16FN3O and a molecular weight of 309.34 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)iminomethyl]-5-methyl-2-(4-methylphenyl)-1H-pyrazol-3-one.
| Compound Name | 4-[(4-fluorophenyl)iminomethyl]-5-methyl-2-(4-methylphenyl)-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 711577 |
| Molecular Formula | C18H16FN3O |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 4-[(4-fluorophenyl)iminomethyl]-5-methyl-2-(4-methylphenyl)-1H-pyrazol-3-one |
| SMILES | Cc1ccc(-n2[nH]c(C)c(/C=N/c3ccc(F)cc3)c2=O)cc1 |
| InChI | InChI=1S/C18H16FN3O/c1-12-3-9-16(10-4-12)22-18(23)17(13(2)21-22)11-20-15-7-5-14(19)6-8-15/h3-11,21H,1-2H3/b20-11+ |
| InChIKey | ZBZNKFJOWRGVJC-RGVLZGJSSA-N |
| XLogP | 3.67 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|