C18H19N5O — CID 4970735
2-(4,6-dimethylpyrimidin-2-yl)-5-methyl-4-[(4-methylphenyl)iminomethyl]-1H-pyrazol-3-one (PubChem CID 4970735) has the molecular formula C18H19N5O and a molecular weight of 321.38 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-2-yl)-5-methyl-4-[(4-methylphenyl)iminomethyl]-1H-pyrazol-3-one.
| Compound Name | 2-(4,6-dimethylpyrimidin-2-yl)-5-methyl-4-[(4-methylphenyl)iminomethyl]-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 4970735 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-2-yl)-5-methyl-4-[(4-methylphenyl)iminomethyl]-1H-pyrazol-3-one |
| SMILES | Cc1ccc(/N=C/c2c(C)[nH]n(-c3nc(C)cc(C)n3)c2=O)cc1 |
| InChI | InChI=1S/C18H19N5O/c1-11-5-7-15(8-6-11)19-10-16-14(4)22-23(17(16)24)18-20-12(2)9-13(3)21-18/h5-10,22H,1-4H3/b19-10+ |
| InChIKey | HENIFALMMDRWBO-VXLYETTFSA-N |
| XLogP | 2.94 |
| TPSA | 75.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|