C19H16N4OS — CID 792459
[4-[[5-methyl-2-(4-methylphenyl)-3-oxo-1H-pyrazol-4-yl]methylideneamino]phenyl] thiocyanate (PubChem CID 792459) has the molecular formula C19H16N4OS and a molecular weight of 348.43 g/mol. Its IUPAC name is [4-[[5-methyl-2-(4-methylphenyl)-3-oxo-1H-pyrazol-4-yl]methylideneamino]phenyl] thiocyanate.
| Compound Name | [4-[[5-methyl-2-(4-methylphenyl)-3-oxo-1H-pyrazol-4-yl]methylideneamino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 792459 |
| Molecular Formula | C19H16N4OS |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | [4-[[5-methyl-2-(4-methylphenyl)-3-oxo-1H-pyrazol-4-yl]methylideneamino]phenyl] thiocyanate |
| SMILES | Cc1ccc(-n2[nH]c(C)c(/C=N/c3ccc(SC#N)cc3)c2=O)cc1 |
| InChI | InChI=1S/C19H16N4OS/c1-13-3-7-16(8-4-13)23-19(24)18(14(2)22-23)11-21-15-5-9-17(10-6-15)25-12-20/h3-11,22H,1-2H3/b21-11+ |
| InChIKey | WLZIDTKFCHYKKA-SRZZPIQSSA-N |
| XLogP | 4.11 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|