C20H16Cl2N4O3S — CID 135467678
ethyl 4-[(E)-(2,4-dichlorophenyl)carbamothioyliminomethyl]-3-oxo-2-phenyl-1H-pyrazole-5-carboxylate (PubChem CID 135467678) has the molecular formula C20H16Cl2N4O3S and a molecular weight of 463.35 g/mol. Its IUPAC name is ethyl 4-[(E)-(2,4-dichlorophenyl)carbamothioyliminomethyl]-3-oxo-2-phenyl-1H-pyrazole-5-carboxylate.
| Compound Name | ethyl 4-[(E)-(2,4-dichlorophenyl)carbamothioyliminomethyl]-3-oxo-2-phenyl-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 135467678 |
| Molecular Formula | C20H16Cl2N4O3S |
| Molecular Weight | 463.35 g/mol |
| Exact Mass | 462.03 |
| IUPAC Name | ethyl 4-[(E)-(2,4-dichlorophenyl)carbamothioyliminomethyl]-3-oxo-2-phenyl-1H-pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1[nH]n(-c2ccccc2)c(=O)c1/C=N/C(=S)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H16Cl2N4O3S/c1-2-29-19(28)17-14(18(27)26(25-17)13-6-4-3-5-7-13)11-23-20(30)24-16-9-8-12(21)10-15(16)22/h3-11,25H,2H2,1H3,(H,24,30)/b23-11+ |
| InChIKey | LNZCQIGQOLTMRF-FOKLQQMPSA-N |
| XLogP | 4.47 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.35 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|