C13H9Cl2NO — CID 677290
2-[(2,6-dichlorophenyl)methylideneamino]phenol (PubChem CID 677290) has the molecular formula C13H9Cl2NO and a molecular weight of 266.13 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methylideneamino]phenol.
| Compound Name | 2-[(2,6-dichlorophenyl)methylideneamino]phenol |
|---|---|
| PubChem CID | 677290 |
| Molecular Formula | C13H9Cl2NO |
| Molecular Weight | 266.13 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methylideneamino]phenol |
| SMILES | Oc1ccccc1/N=C/c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H9Cl2NO/c14-10-4-3-5-11(15)9(10)8-16-12-6-1-2-7-13(12)17/h1-8,17H/b16-8+ |
| InChIKey | GYHNHYVUICZMLA-LZYBPNLTSA-N |
| XLogP | 4.45 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.13 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|