C40H36CoN8O16S2 — CID 170525122
cobalt;bis(ethyl 5-hydroxy-4-[(2-hydroxy-5-methylsulfonylphenyl)iminomethyl]-1-(4-nitrophenyl)pyrazole-3-carboxylate) (PubChem CID 170525122) has the molecular formula C40H36CoN8O16S2 and a molecular weight of 1007.83 g/mol. Its IUPAC name is cobalt;bis(ethyl 5-hydroxy-4-[(2-hydroxy-5-methylsulfonylphenyl)iminomethyl]-1-(4-nitrophenyl)pyrazole-3-carboxylate).
| Compound Name | cobalt;bis(ethyl 5-hydroxy-4-[(2-hydroxy-5-methylsulfonylphenyl)iminomethyl]-1-(4-nitrophenyl)pyrazole-3-carboxylate) |
|---|---|
| PubChem CID | 170525122 |
| Molecular Formula | C40H36CoN8O16S2 |
| Molecular Weight | 1007.83 g/mol |
| Exact Mass | 1007.10 |
| IUPAC Name | cobalt;bis(ethyl 5-hydroxy-4-[(2-hydroxy-5-methylsulfonylphenyl)iminomethyl]-1-(4-nitrophenyl)pyrazole-3-carboxylate) |
| SMILES | CCOC(=O)c1nn(-c2ccc([N+](=O)[O-])cc2)c(O)c1/C=N\c1cc(S(C)(=O)=O)ccc1O.CCOC(=O)c1nn(-c2ccc([N+](=O)[O-])cc2)c(O)c1/C=N\c1cc(S(C)(=O)=O)ccc1O.[Co] |
| InChI | InChI=1S/2C20H18N4O8S.Co/c2*1-3-32-20(27)18-15(11-21-16-10-14(33(2,30)31)8-9-17(16)25)19(26)23(22-18)12-4-6-13(7-5-12)24(28)29;/h2*4-11,25-26H,3H2,1-2H3;/b2*21-11-; |
| InChIKey | QPXVBOZLSVQISG-CNNMDHGUSA-N |
| XLogP | 5.04 |
| TPSA | 348.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1007.83 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 22 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|