C23H25ClN4O4 — CID 162645172
ethyl 4-[(tert-butylamino)methyl]-1-(4-chlorophenyl)-5-(4-nitrophenyl)pyrazole-3-carboxylate (PubChem CID 162645172) has the molecular formula C23H25ClN4O4 and a molecular weight of 456.93 g/mol. Its IUPAC name is ethyl 4-[(tert-butylamino)methyl]-1-(4-chlorophenyl)-5-(4-nitrophenyl)pyrazole-3-carboxylate.
| Compound Name | ethyl 4-[(tert-butylamino)methyl]-1-(4-chlorophenyl)-5-(4-nitrophenyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 162645172 |
| Molecular Formula | C23H25ClN4O4 |
| Molecular Weight | 456.93 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | ethyl 4-[(tert-butylamino)methyl]-1-(4-chlorophenyl)-5-(4-nitrophenyl)pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccc(Cl)cc2)c(-c2ccc([N+](=O)[O-])cc2)c1CNC(C)(C)C |
| InChI | InChI=1S/C23H25ClN4O4/c1-5-32-22(29)20-19(14-25-23(2,3)4)21(15-6-10-18(11-7-15)28(30)31)27(26-20)17-12-8-16(24)9-13-17/h6-13,25H,5,14H2,1-4H3 |
| InChIKey | BRDGHANWFQZBJW-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.93 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|