C25H24ClN5O5 — CID 141479385
ethyl 1-(4-chlorophenyl)-5-(4-methoxyphenyl)-4-[2-(2-methyl-5-nitroimidazol-1-yl)ethyl]pyrazole-3-carboxylate (PubChem CID 141479385) has the molecular formula C25H24ClN5O5 and a molecular weight of 509.95 g/mol. Its IUPAC name is ethyl 1-(4-chlorophenyl)-5-(4-methoxyphenyl)-4-[2-(2-methyl-5-nitroimidazol-1-yl)ethyl]pyrazole-3-carboxylate.
| Compound Name | ethyl 1-(4-chlorophenyl)-5-(4-methoxyphenyl)-4-[2-(2-methyl-5-nitroimidazol-1-yl)ethyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 141479385 |
| Molecular Formula | C25H24ClN5O5 |
| Molecular Weight | 509.95 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | ethyl 1-(4-chlorophenyl)-5-(4-methoxyphenyl)-4-[2-(2-methyl-5-nitroimidazol-1-yl)ethyl]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccc(Cl)cc2)c(-c2ccc(OC)cc2)c1CCn1c([N+](=O)[O-])cnc1C |
| InChI | InChI=1S/C25H24ClN5O5/c1-4-36-25(32)23-21(13-14-29-16(2)27-15-22(29)31(33)34)24(17-5-11-20(35-3)12-6-17)30(28-23)19-9-7-18(26)8-10-19/h5-12,15H,4,13-14H2,1-3H3 |
| InChIKey | DZGJAFRLCZPKRR-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 114.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.95 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|