C24H22ClN5O4 — CID 141479376
ethyl 5-(4-chlorophenyl)-4-[2-(2-methyl-5-nitroimidazol-1-yl)ethyl]-1-phenylpyrazole-3-carboxylate (PubChem CID 141479376) has the molecular formula C24H22ClN5O4 and a molecular weight of 479.92 g/mol. Its IUPAC name is ethyl 5-(4-chlorophenyl)-4-[2-(2-methyl-5-nitroimidazol-1-yl)ethyl]-1-phenylpyrazole-3-carboxylate.
| Compound Name | ethyl 5-(4-chlorophenyl)-4-[2-(2-methyl-5-nitroimidazol-1-yl)ethyl]-1-phenylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 141479376 |
| Molecular Formula | C24H22ClN5O4 |
| Molecular Weight | 479.92 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | ethyl 5-(4-chlorophenyl)-4-[2-(2-methyl-5-nitroimidazol-1-yl)ethyl]-1-phenylpyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccccc2)c(-c2ccc(Cl)cc2)c1CCn1c([N+](=O)[O-])cnc1C |
| InChI | InChI=1S/C24H22ClN5O4/c1-3-34-24(31)22-20(13-14-28-16(2)26-15-21(28)30(32)33)23(17-9-11-18(25)12-10-17)29(27-22)19-7-5-4-6-8-19/h4-12,15H,3,13-14H2,1-2H3 |
| InChIKey | WWRSBPPAIHAEFP-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 105.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.92 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|