C22H18FN3O4 — CID 45115346
ethyl 1-(4-fluorophenyl)-6-[(4-nitrophenyl)methylidene]-4,5-dihydrocyclopenta[d]pyrazole-3-carboxylate (PubChem CID 45115346) has the molecular formula C22H18FN3O4 and a molecular weight of 407.40 g/mol. Its IUPAC name is ethyl 1-(4-fluorophenyl)-6-[(4-nitrophenyl)methylidene]-4,5-dihydrocyclopenta[d]pyrazole-3-carboxylate.
| Compound Name | ethyl 1-(4-fluorophenyl)-6-[(4-nitrophenyl)methylidene]-4,5-dihydrocyclopenta[d]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 45115346 |
| Molecular Formula | C22H18FN3O4 |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | ethyl 1-(4-fluorophenyl)-6-[(4-nitrophenyl)methylidene]-4,5-dihydrocyclopenta[d]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccc(F)cc2)c2c1CCC2=Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H18FN3O4/c1-2-30-22(27)20-19-12-5-15(13-14-3-8-18(9-4-14)26(28)29)21(19)25(24-20)17-10-6-16(23)7-11-17/h3-4,6-11,13H,2,5,12H2,1H3 |
| InChIKey | OLGBWPULNINMAJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|