C22H19N3O7 — CID 24829077
ethyl (3E,5E)-3,5-bis[(4-nitrophenyl)methylidene]-4-oxopiperidine-1-carboxylate (PubChem CID 24829077) has the molecular formula C22H19N3O7 and a molecular weight of 437.41 g/mol. Its IUPAC name is ethyl (3E,5E)-3,5-bis[(4-nitrophenyl)methylidene]-4-oxopiperidine-1-carboxylate.
| Compound Name | ethyl (3E,5E)-3,5-bis[(4-nitrophenyl)methylidene]-4-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 24829077 |
| Molecular Formula | C22H19N3O7 |
| Molecular Weight | 437.41 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | ethyl (3E,5E)-3,5-bis[(4-nitrophenyl)methylidene]-4-oxopiperidine-1-carboxylate |
| SMILES | CCOC(=O)N1C/C(=C\c2ccc([N+](=O)[O-])cc2)C(=O)/C(=C/c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C22H19N3O7/c1-2-32-22(27)23-13-17(11-15-3-7-19(8-4-15)24(28)29)21(26)18(14-23)12-16-5-9-20(10-6-16)25(30)31/h3-12H,2,13-14H2,1H3/b17-11+,18-12+ |
| InChIKey | FZWOFMTVDGIZGU-JYFOCSDGSA-N |
| XLogP | 4.01 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|