C22H22N3O8P — CID 42630858
3-[(3E,5E)-3,5-bis[(4-nitrophenyl)methylidene]-4-oxopiperidin-1-yl]propylphosphonic acid (PubChem CID 42630858) has the molecular formula C22H22N3O8P and a molecular weight of 487.41 g/mol. Its IUPAC name is 3-[(3E,5E)-3,5-bis[(4-nitrophenyl)methylidene]-4-oxopiperidin-1-yl]propylphosphonic acid.
| Compound Name | 3-[(3E,5E)-3,5-bis[(4-nitrophenyl)methylidene]-4-oxopiperidin-1-yl]propylphosphonic acid |
|---|---|
| PubChem CID | 42630858 |
| Molecular Formula | C22H22N3O8P |
| Molecular Weight | 487.41 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | 3-[(3E,5E)-3,5-bis[(4-nitrophenyl)methylidene]-4-oxopiperidin-1-yl]propylphosphonic acid |
| SMILES | O=C1/C(=C/c2ccc([N+](=O)[O-])cc2)CN(CCCP(=O)(O)O)C/C1=C\c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H22N3O8P/c26-22-18(12-16-2-6-20(7-3-16)24(27)28)14-23(10-1-11-34(31,32)33)15-19(22)13-17-4-8-21(9-5-17)25(29)30/h2-9,12-13H,1,10-11,14-15H2,(H2,31,32,33)/b18-12+,19-13+ |
| InChIKey | MRXTVXUJFJITPN-KLCVKJMQSA-N |
| XLogP | 3.42 |
| TPSA | 164.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|