C23H20N2O7 — CID 75946127
ethyl 3,5-bis[(4-nitrophenyl)methylidene]-4-oxocyclohexane-1-carboxylate (PubChem CID 75946127) has the molecular formula C23H20N2O7 and a molecular weight of 436.42 g/mol. Its IUPAC name is ethyl 3,5-bis[(4-nitrophenyl)methylidene]-4-oxocyclohexane-1-carboxylate.
| Compound Name | ethyl 3,5-bis[(4-nitrophenyl)methylidene]-4-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 75946127 |
| Molecular Formula | C23H20N2O7 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | ethyl 3,5-bis[(4-nitrophenyl)methylidene]-4-oxocyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CC(=Cc2ccc([N+](=O)[O-])cc2)C(=O)C(=Cc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C23H20N2O7/c1-2-32-23(27)19-13-17(11-15-3-7-20(8-4-15)24(28)29)22(26)18(14-19)12-16-5-9-21(10-6-16)25(30)31/h3-12,19H,2,13-14H2,1H3 |
| InChIKey | OTVIWKDZSAWVIQ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 129.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|