C21H16N2O6 — CID 6176725
(3E,7E)-3,7-bis[(4-nitrophenyl)methylidene]cycloheptane-1,2-dione (PubChem CID 6176725) has the molecular formula C21H16N2O6 and a molecular weight of 392.37 g/mol. Its IUPAC name is (3E,7E)-3,7-bis[(4-nitrophenyl)methylidene]cycloheptane-1,2-dione.
| Compound Name | (3E,7E)-3,7-bis[(4-nitrophenyl)methylidene]cycloheptane-1,2-dione |
|---|---|
| PubChem CID | 6176725 |
| Molecular Formula | C21H16N2O6 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | (3E,7E)-3,7-bis[(4-nitrophenyl)methylidene]cycloheptane-1,2-dione |
| SMILES | O=C1C(=O)/C(=C/c2ccc([N+](=O)[O-])cc2)CCC/C1=C\c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H16N2O6/c24-20-16(12-14-4-8-18(9-5-14)22(26)27)2-1-3-17(21(20)25)13-15-6-10-19(11-7-15)23(28)29/h4-13H,1-3H2/b16-12+,17-13+ |
| InChIKey | OMQUVUPABDCOHI-UNZYHPAISA-N |
| XLogP | 4.29 |
| TPSA | 120.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|