C20H17N3O5 — CID 167344976
(2S,3E,5E)-2-methyl-3,5-bis[(4-nitrophenyl)methylidene]piperidin-4-one (PubChem CID 167344976) has the molecular formula C20H17N3O5 and a molecular weight of 379.37 g/mol. Its IUPAC name is (2S,3E,5E)-2-methyl-3,5-bis[(4-nitrophenyl)methylidene]piperidin-4-one.
| Compound Name | (2S,3E,5E)-2-methyl-3,5-bis[(4-nitrophenyl)methylidene]piperidin-4-one |
|---|---|
| PubChem CID | 167344976 |
| Molecular Formula | C20H17N3O5 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | (2S,3E,5E)-2-methyl-3,5-bis[(4-nitrophenyl)methylidene]piperidin-4-one |
| SMILES | C[C@@H]1NC/C(=C\c2ccc([N+](=O)[O-])cc2)C(=O)/C1=C/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H17N3O5/c1-13-19(11-15-4-8-18(9-5-15)23(27)28)20(24)16(12-21-13)10-14-2-6-17(7-3-14)22(25)26/h2-11,13,21H,12H2,1H3/b16-10+,19-11+/t13-/m0/s1 |
| InChIKey | DFKVAEDMKDIHKF-FJIXDIQWSA-N |
| XLogP | 3.53 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|