About N-ethoxy-2-[(4-nitrophenyl)methylidene]cyclohexan-1-imine;N-methylmethanamine
N-ethoxy-2-[(4-nitrophenyl)methylidene]cyclohexan-1-imine;N-methylmethanamine (PubChem CID 173451113) has the molecular formula C17H25N3O3
and a molecular weight of 319.41 g/mol. Its IUPAC name is N-ethoxy-2-[(4-nitrophenyl)methylidene]cyclohexan-1-imine;N-methylmethanamine.
Molecular Properties
| Compound Name | N-ethoxy-2-[(4-nitrophenyl)methylidene]cyclohexan-1-imine;N-methylmethanamine |
| PubChem CID | 173451113 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | N-ethoxy-2-[(4-nitrophenyl)methylidene]cyclohexan-1-imine;N-methylmethanamine |
| SMILES | CCON=C1CCCCC1=Cc1ccc([N+](=O)[O-])cc1.CNC |
| InChI | InChI=1S/C15H18N2O3.C2H7N/c1-2-20-16-15-6-4-3-5-13(15)11-12-7-9-14(10-8-12)17(18)19;1-3-2/h7-11H,2-6H2,1H3;3H,1-2H3 |
| InChIKey | OOGBZICDGKGNQW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-ethoxy-2-[(4-nitrophenyl)methylidene]cyclohexan-1-imine;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethoxy-2-[(4-nitrophenyl)methylidene]cyclohexan-1-imine;N-methylmethanamine?
The IUPAC name of N-ethoxy-2-[(4-nitrophenyl)methylidene]cyclohexan-1-imine;N-methylmethanamine (CID 173451113) is N-ethoxy-2-[(4-nitrophenyl)methylidene]cyclohexan-1-imine;N-methylmethanamine.
What is the SMILES notation for N-ethoxy-2-[(4-nitrophenyl)methylidene]cyclohexan-1-imine;N-methylmethanamine?
The canonical SMILES for N-ethoxy-2-[(4-nitrophenyl)methylidene]cyclohexan-1-imine;N-methylmethanamine is CCON=C1CCCCC1=Cc1ccc([N+](=O)[O-])cc1.CNC.
What is the InChIKey of N-ethoxy-2-[(4-nitrophenyl)methylidene]cyclohexan-1-imine;N-methylmethanamine?
The InChIKey is OOGBZICDGKGNQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O3.C2H7N/c1-2-20-16-15-6-4-3-5-13(15)11-12-7-9-14(10-8-12)17(18)19;1-3-2/h7-11H,2-6H2,1H3;3H,1-2H3.
What are the key properties of N-ethoxy-2-[(4-nitrophenyl)methylidene]cyclohexan-1-imine;N-methylmethanamine?
N-ethoxy-2-[(4-nitrophenyl)methylidene]cyclohexan-1-imine;N-methylmethanamine has a molecular weight of 319.41 g/mol, XLogP of 3.78, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethoxy-2-[(4-nitrophenyl)methylidene]cyclohexan-1-imine;N-methylmethanamine is sourced from PubChem (CID 173451113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).