About 1-(cyclobutylidenemethyl)-4-nitrobenzene;4-ethyl-2-methylaniline
1-(cyclobutylidenemethyl)-4-nitrobenzene;4-ethyl-2-methylaniline (PubChem CID 145267817) has the molecular formula C20H24N2O2
and a molecular weight of 324.42 g/mol. Its IUPAC name is 1-(cyclobutylidenemethyl)-4-nitrobenzene;4-ethyl-2-methylaniline.
Molecular Properties
| Compound Name | 1-(cyclobutylidenemethyl)-4-nitrobenzene;4-ethyl-2-methylaniline |
| PubChem CID | 145267817 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 1-(cyclobutylidenemethyl)-4-nitrobenzene;4-ethyl-2-methylaniline |
| SMILES | CCc1ccc(N)c(C)c1.O=[N+]([O-])c1ccc(C=C2CCC2)cc1 |
| InChI | InChI=1S/C11H11NO2.C9H13N/c13-12(14)11-6-4-10(5-7-11)8-9-2-1-3-9;1-3-8-4-5-9(10)7(2)6-8/h4-8H,1-3H2;4-6H,3,10H2,1-2H3 |
| InChIKey | SQUXAYSSUASVCW-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(cyclobutylidenemethyl)-4-nitrobenzene;4-ethyl-2-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclobutylidenemethyl)-4-nitrobenzene;4-ethyl-2-methylaniline?
The IUPAC name of 1-(cyclobutylidenemethyl)-4-nitrobenzene;4-ethyl-2-methylaniline (CID 145267817) is 1-(cyclobutylidenemethyl)-4-nitrobenzene;4-ethyl-2-methylaniline.
What is the SMILES notation for 1-(cyclobutylidenemethyl)-4-nitrobenzene;4-ethyl-2-methylaniline?
The canonical SMILES for 1-(cyclobutylidenemethyl)-4-nitrobenzene;4-ethyl-2-methylaniline is CCc1ccc(N)c(C)c1.O=[N+]([O-])c1ccc(C=C2CCC2)cc1.
What is the InChIKey of 1-(cyclobutylidenemethyl)-4-nitrobenzene;4-ethyl-2-methylaniline?
The InChIKey is SQUXAYSSUASVCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2.C9H13N/c13-12(14)11-6-4-10(5-7-11)8-9-2-1-3-9;1-3-8-4-5-9(10)7(2)6-8/h4-8H,1-3H2;4-6H,3,10H2,1-2H3.
What are the key properties of 1-(cyclobutylidenemethyl)-4-nitrobenzene;4-ethyl-2-methylaniline?
1-(cyclobutylidenemethyl)-4-nitrobenzene;4-ethyl-2-methylaniline has a molecular weight of 324.42 g/mol, XLogP of 5.30, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclobutylidenemethyl)-4-nitrobenzene;4-ethyl-2-methylaniline is sourced from PubChem (CID 145267817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).