C21H27ClN2O2 — CID 145267771
1-(4-chlorophenyl)-N,N-dimethylmethanamine;1-(cyclobutylidenemethyl)-4-nitrobenzene;methane (PubChem CID 145267771) has the molecular formula C21H27ClN2O2 and a molecular weight of 374.91 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N,N-dimethylmethanamine;1-(cyclobutylidenemethyl)-4-nitrobenzene;methane.
| Compound Name | 1-(4-chlorophenyl)-N,N-dimethylmethanamine;1-(cyclobutylidenemethyl)-4-nitrobenzene;methane |
|---|---|
| PubChem CID | 145267771 |
| Molecular Formula | C21H27ClN2O2 |
| Molecular Weight | 374.91 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 1-(4-chlorophenyl)-N,N-dimethylmethanamine;1-(cyclobutylidenemethyl)-4-nitrobenzene;methane |
| SMILES | C.CN(C)Cc1ccc(Cl)cc1.O=[N+]([O-])c1ccc(C=C2CCC2)cc1 |
| InChI | InChI=1S/C11H11NO2.C9H12ClN.CH4/c13-12(14)11-6-4-10(5-7-11)8-9-2-1-3-9;1-11(2)7-8-3-5-9(10)6-4-8;/h4-8H,1-3H2;3-6H,7H2,1-2H3;1H4 |
| InChIKey | WERIJUVECGNHRV-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.91 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|