About 2-methylbenzene-1,4-diamine;nitrobenzene
2-methylbenzene-1,4-diamine;nitrobenzene (PubChem CID 174411742) has the molecular formula C13H15N3O2
and a molecular weight of 245.28 g/mol. Its IUPAC name is 2-methylbenzene-1,4-diamine;nitrobenzene.
Molecular Properties
| Compound Name | 2-methylbenzene-1,4-diamine;nitrobenzene |
| PubChem CID | 174411742 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 2-methylbenzene-1,4-diamine;nitrobenzene |
| SMILES | Cc1cc(N)ccc1N.O=[N+]([O-])c1ccccc1 |
| InChI | InChI=1S/C7H10N2.C6H5NO2/c1-5-4-6(8)2-3-7(5)9;8-7(9)6-4-2-1-3-5-6/h2-4H,8-9H2,1H3;1-5H |
| InChIKey | VLNYOVHQLWRBJM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbenzene-1,4-diamine;nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbenzene-1,4-diamine;nitrobenzene?
The IUPAC name of 2-methylbenzene-1,4-diamine;nitrobenzene (CID 174411742) is 2-methylbenzene-1,4-diamine;nitrobenzene.
What is the SMILES notation for 2-methylbenzene-1,4-diamine;nitrobenzene?
The canonical SMILES for 2-methylbenzene-1,4-diamine;nitrobenzene is Cc1cc(N)ccc1N.O=[N+]([O-])c1ccccc1.
What is the InChIKey of 2-methylbenzene-1,4-diamine;nitrobenzene?
The InChIKey is VLNYOVHQLWRBJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.C6H5NO2/c1-5-4-6(8)2-3-7(5)9;8-7(9)6-4-2-1-3-5-6/h2-4H,8-9H2,1H3;1-5H.
What are the key properties of 2-methylbenzene-1,4-diamine;nitrobenzene?
2-methylbenzene-1,4-diamine;nitrobenzene has a molecular weight of 245.28 g/mol, XLogP of 2.75, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbenzene-1,4-diamine;nitrobenzene is sourced from PubChem (CID 174411742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).