About aniline;2-methyl-5-nitroaniline
aniline;2-methyl-5-nitroaniline (PubChem CID 154966094) has the molecular formula C13H15N3O2
and a molecular weight of 245.28 g/mol. Its IUPAC name is aniline;2-methyl-5-nitroaniline.
Molecular Properties
| Compound Name | aniline;2-methyl-5-nitroaniline |
| PubChem CID | 154966094 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | aniline;2-methyl-5-nitroaniline |
| SMILES | Cc1ccc([N+](=O)[O-])cc1N.Nc1ccccc1 |
| InChI | InChI=1S/C7H8N2O2.C6H7N/c1-5-2-3-6(9(10)11)4-7(5)8;7-6-4-2-1-3-5-6/h2-4H,8H2,1H3;1-5H,7H2 |
| InChIKey | PHRNPPWZVWPTOL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze aniline;2-methyl-5-nitroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;2-methyl-5-nitroaniline?
The IUPAC name of aniline;2-methyl-5-nitroaniline (CID 154966094) is aniline;2-methyl-5-nitroaniline.
What is the SMILES notation for aniline;2-methyl-5-nitroaniline?
The canonical SMILES for aniline;2-methyl-5-nitroaniline is Cc1ccc([N+](=O)[O-])cc1N.Nc1ccccc1.
What is the InChIKey of aniline;2-methyl-5-nitroaniline?
The InChIKey is PHRNPPWZVWPTOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2.C6H7N/c1-5-2-3-6(9(10)11)4-7(5)8;7-6-4-2-1-3-5-6/h2-4H,8H2,1H3;1-5H,7H2.
What are the key properties of aniline;2-methyl-5-nitroaniline?
aniline;2-methyl-5-nitroaniline has a molecular weight of 245.28 g/mol, XLogP of 2.75, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;2-methyl-5-nitroaniline is sourced from PubChem (CID 154966094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).