About 3-methoxypropan-1-amine;2-methyl-5-nitroaniline
3-methoxypropan-1-amine;2-methyl-5-nitroaniline (PubChem CID 159209336) has the molecular formula C11H19N3O3
and a molecular weight of 241.29 g/mol. Its IUPAC name is 3-methoxypropan-1-amine;2-methyl-5-nitroaniline.
Molecular Properties
| Compound Name | 3-methoxypropan-1-amine;2-methyl-5-nitroaniline |
| PubChem CID | 159209336 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 3-methoxypropan-1-amine;2-methyl-5-nitroaniline |
| SMILES | COCCCN.Cc1ccc([N+](=O)[O-])cc1N |
| InChI | InChI=1S/C7H8N2O2.C4H11NO/c1-5-2-3-6(9(10)11)4-7(5)8;1-6-4-2-3-5/h2-4H,8H2,1H3;2-5H2,1H3 |
| InChIKey | KQHFOCIWVVNXHY-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 104.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxypropan-1-amine;2-methyl-5-nitroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxypropan-1-amine;2-methyl-5-nitroaniline?
The IUPAC name of 3-methoxypropan-1-amine;2-methyl-5-nitroaniline (CID 159209336) is 3-methoxypropan-1-amine;2-methyl-5-nitroaniline.
What is the SMILES notation for 3-methoxypropan-1-amine;2-methyl-5-nitroaniline?
The canonical SMILES for 3-methoxypropan-1-amine;2-methyl-5-nitroaniline is COCCCN.Cc1ccc([N+](=O)[O-])cc1N.
What is the InChIKey of 3-methoxypropan-1-amine;2-methyl-5-nitroaniline?
The InChIKey is KQHFOCIWVVNXHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2.C4H11NO/c1-5-2-3-6(9(10)11)4-7(5)8;1-6-4-2-3-5/h2-4H,8H2,1H3;2-5H2,1H3.
What are the key properties of 3-methoxypropan-1-amine;2-methyl-5-nitroaniline?
3-methoxypropan-1-amine;2-methyl-5-nitroaniline has a molecular weight of 241.29 g/mol, XLogP of 1.47, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxypropan-1-amine;2-methyl-5-nitroaniline is sourced from PubChem (CID 159209336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).