About aniline;1,2-dichloro-4-nitrobenzene
aniline;1,2-dichloro-4-nitrobenzene (PubChem CID 86084076) has the molecular formula C12H10Cl2N2O2
and a molecular weight of 285.13 g/mol. Its IUPAC name is aniline;1,2-dichloro-4-nitrobenzene.
Molecular Properties
| Compound Name | aniline;1,2-dichloro-4-nitrobenzene |
| PubChem CID | 86084076 |
| Molecular Formula | C12H10Cl2N2O2 |
| Molecular Weight | 285.13 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | aniline;1,2-dichloro-4-nitrobenzene |
| SMILES | Nc1ccccc1.O=[N+]([O-])c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C6H3Cl2NO2.C6H7N/c7-5-2-1-4(9(10)11)3-6(5)8;7-6-4-2-1-3-5-6/h1-3H;1-5H,7H2 |
| InChIKey | WYNYQAIYVYJEEO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.13 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze aniline;1,2-dichloro-4-nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;1,2-dichloro-4-nitrobenzene?
The IUPAC name of aniline;1,2-dichloro-4-nitrobenzene (CID 86084076) is aniline;1,2-dichloro-4-nitrobenzene.
What is the SMILES notation for aniline;1,2-dichloro-4-nitrobenzene?
The canonical SMILES for aniline;1,2-dichloro-4-nitrobenzene is Nc1ccccc1.O=[N+]([O-])c1ccc(Cl)c(Cl)c1.
What is the InChIKey of aniline;1,2-dichloro-4-nitrobenzene?
The InChIKey is WYNYQAIYVYJEEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Cl2NO2.C6H7N/c7-5-2-1-4(9(10)11)3-6(5)8;7-6-4-2-1-3-5-6/h1-3H;1-5H,7H2.
What are the key properties of aniline;1,2-dichloro-4-nitrobenzene?
aniline;1,2-dichloro-4-nitrobenzene has a molecular weight of 285.13 g/mol, XLogP of 4.17, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;1,2-dichloro-4-nitrobenzene is sourced from PubChem (CID 86084076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).