C12H6Cl4FNO2 — CID 141059072
1,3-dichloro-2-fluorobenzene;1,2-dichloro-4-nitrobenzene (PubChem CID 141059072) has the molecular formula C12H6Cl4FNO2 and a molecular weight of 357.00 g/mol. Its IUPAC name is 1,3-dichloro-2-fluorobenzene;1,2-dichloro-4-nitrobenzene.
| Compound Name | 1,3-dichloro-2-fluorobenzene;1,2-dichloro-4-nitrobenzene |
|---|---|
| PubChem CID | 141059072 |
| Molecular Formula | C12H6Cl4FNO2 |
| Molecular Weight | 357.00 g/mol |
| Exact Mass | 354.91 |
| IUPAC Name | 1,3-dichloro-2-fluorobenzene;1,2-dichloro-4-nitrobenzene |
| SMILES | Fc1c(Cl)cccc1Cl.O=[N+]([O-])c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C6H3Cl2F.C6H3Cl2NO2/c7-4-2-1-3-5(8)6(4)9;7-5-2-1-4(9(10)11)3-6(5)8/h1-3H;1-3H |
| InChIKey | YWEUUVHPMUKUKW-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.00 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|