About 3-chloroaniline;2-chloro-4-nitroaniline
3-chloroaniline;2-chloro-4-nitroaniline (PubChem CID 159343483) has the molecular formula C12H11Cl2N3O2
and a molecular weight of 300.15 g/mol. Its IUPAC name is 3-chloroaniline;2-chloro-4-nitroaniline.
Molecular Properties
| Compound Name | 3-chloroaniline;2-chloro-4-nitroaniline |
| PubChem CID | 159343483 |
| Molecular Formula | C12H11Cl2N3O2 |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 3-chloroaniline;2-chloro-4-nitroaniline |
| SMILES | Nc1ccc([N+](=O)[O-])cc1Cl.Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C6H5ClN2O2.C6H6ClN/c7-5-3-4(9(10)11)1-2-6(5)8;7-5-2-1-3-6(8)4-5/h1-3H,8H2;1-4H,8H2 |
| InChIKey | LGKQOZNBADJHLB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-chloroaniline;2-chloro-4-nitroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloroaniline;2-chloro-4-nitroaniline?
The IUPAC name of 3-chloroaniline;2-chloro-4-nitroaniline (CID 159343483) is 3-chloroaniline;2-chloro-4-nitroaniline.
What is the SMILES notation for 3-chloroaniline;2-chloro-4-nitroaniline?
The canonical SMILES for 3-chloroaniline;2-chloro-4-nitroaniline is Nc1ccc([N+](=O)[O-])cc1Cl.Nc1cccc(Cl)c1.
What is the InChIKey of 3-chloroaniline;2-chloro-4-nitroaniline?
The InChIKey is LGKQOZNBADJHLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClN2O2.C6H6ClN/c7-5-3-4(9(10)11)1-2-6(5)8;7-5-2-1-3-6(8)4-5/h1-3H,8H2;1-4H,8H2.
What are the key properties of 3-chloroaniline;2-chloro-4-nitroaniline?
3-chloroaniline;2-chloro-4-nitroaniline has a molecular weight of 300.15 g/mol, XLogP of 3.75, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloroaniline;2-chloro-4-nitroaniline is sourced from PubChem (CID 159343483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).