About 2-chloro-4-nitroaniline;naphthalen-2-ol
2-chloro-4-nitroaniline;naphthalen-2-ol (PubChem CID 70601980) has the molecular formula C16H13ClN2O3
and a molecular weight of 316.74 g/mol. Its IUPAC name is 2-chloro-4-nitroaniline;naphthalen-2-ol.
Molecular Properties
| Compound Name | 2-chloro-4-nitroaniline;naphthalen-2-ol |
| PubChem CID | 70601980 |
| Molecular Formula | C16H13ClN2O3 |
| Molecular Weight | 316.74 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 2-chloro-4-nitroaniline;naphthalen-2-ol |
| SMILES | Nc1ccc([N+](=O)[O-])cc1Cl.Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8O.C6H5ClN2O2/c11-10-6-5-8-3-1-2-4-9(8)7-10;7-5-3-4(9(10)11)1-2-6(5)8/h1-7,11H;1-3H,8H2 |
| InChIKey | CSZQAQHQPHDECO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.74 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-nitroaniline;naphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-nitroaniline;naphthalen-2-ol?
The IUPAC name of 2-chloro-4-nitroaniline;naphthalen-2-ol (CID 70601980) is 2-chloro-4-nitroaniline;naphthalen-2-ol.
What is the SMILES notation for 2-chloro-4-nitroaniline;naphthalen-2-ol?
The canonical SMILES for 2-chloro-4-nitroaniline;naphthalen-2-ol is Nc1ccc([N+](=O)[O-])cc1Cl.Oc1ccc2ccccc2c1.
What is the InChIKey of 2-chloro-4-nitroaniline;naphthalen-2-ol?
The InChIKey is CSZQAQHQPHDECO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O.C6H5ClN2O2/c11-10-6-5-8-3-1-2-4-9(8)7-10;7-5-3-4(9(10)11)1-2-6(5)8/h1-7,11H;1-3H,8H2.
What are the key properties of 2-chloro-4-nitroaniline;naphthalen-2-ol?
2-chloro-4-nitroaniline;naphthalen-2-ol has a molecular weight of 316.74 g/mol, XLogP of 4.38, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-nitroaniline;naphthalen-2-ol is sourced from PubChem (CID 70601980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).