C20H7Cl12NO2 — CID 57354038
bis(1,2,3,4,5,5-hexachlorocyclopenta-1,3-diene);2-nitronaphthalene (PubChem CID 57354038) has the molecular formula C20H7Cl12NO2 and a molecular weight of 718.72 g/mol. Its IUPAC name is bis(1,2,3,4,5,5-hexachlorocyclopenta-1,3-diene);2-nitronaphthalene.
| Compound Name | bis(1,2,3,4,5,5-hexachlorocyclopenta-1,3-diene);2-nitronaphthalene |
|---|---|
| PubChem CID | 57354038 |
| Molecular Formula | C20H7Cl12NO2 |
| Molecular Weight | 718.72 g/mol |
| Exact Mass | 712.67 |
| IUPAC Name | bis(1,2,3,4,5,5-hexachlorocyclopenta-1,3-diene);2-nitronaphthalene |
| SMILES | ClC1=C(Cl)C(Cl)(Cl)C(Cl)=C1Cl.ClC1=C(Cl)C(Cl)(Cl)C(Cl)=C1Cl.O=[N+]([O-])c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H7NO2.2C5Cl6/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10;2*6-1-2(7)4(9)5(10,11)3(1)8/h1-7H;; |
| InChIKey | TWYBVQUMXIGJKF-UHFFFAOYSA-N |
| XLogP | 11.85 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.72 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|